C17H19NO — CID 171265056
(1R,2S)-1-amino-1-(9H-fluoren-2-yl)butan-2-ol (PubChem CID 171265056) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(9H-fluoren-2-yl)butan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(9H-fluoren-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 171265056 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1R,2S)-1-amino-1-(9H-fluoren-2-yl)butan-2-ol |
| SMILES | CC[C@H](O)[C@H](N)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C17H19NO/c1-2-16(19)17(18)12-7-8-15-13(10-12)9-11-5-3-4-6-14(11)15/h3-8,10,16-17,19H,2,9,18H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UXQWDHCHDWSEEB-DLBZAZTESA-N |
| XLogP | 3.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |