C16H15F2N — CID 171313299
(1S)-1-(9H-fluoren-2-yl)-3,3-difluoropropan-1-amine (PubChem CID 171313299) has the molecular formula C16H15F2N and a molecular weight of 259.30 g/mol. Its IUPAC name is (1S)-1-(9H-fluoren-2-yl)-3,3-difluoropropan-1-amine.
| Compound Name | (1S)-1-(9H-fluoren-2-yl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313299 |
| Molecular Formula | C16H15F2N |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (1S)-1-(9H-fluoren-2-yl)-3,3-difluoropropan-1-amine |
| SMILES | N[C@@H](CC(F)F)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H15F2N/c17-16(18)9-15(19)11-5-6-14-12(8-11)7-10-3-1-2-4-13(10)14/h1-6,8,15-16H,7,9,19H2/t15-/m0/s1 |
| InChIKey | BQBKOERSJOPLHM-HNNXBMFYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |