C18H20ClN — CID 171233283
(S)-cyclobutyl(9H-fluoren-2-yl)methanamine;hydrochloride (PubChem CID 171233283) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is (S)-cyclobutyl(9H-fluoren-2-yl)methanamine;hydrochloride.
| Compound Name | (S)-cyclobutyl(9H-fluoren-2-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 171233283 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | (S)-cyclobutyl(9H-fluoren-2-yl)methanamine;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc2c(c1)Cc1ccccc1-2)C1CCC1 |
| InChI | InChI=1S/C18H19N.ClH/c19-18(12-5-3-6-12)14-8-9-17-15(11-14)10-13-4-1-2-7-16(13)17;/h1-2,4,7-9,11-12,18H,3,5-6,10,19H2;1H/t18-;/m0./s1 |
| InChIKey | WQUJJIGGDIBCIV-FERBBOLQSA-N |
| XLogP | 4.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |