C12H14N2O2 — CID 171901136
4-(2,3-dihydro-1H-indol-5-yl)-3,4-dihydroxybutanenitrile (PubChem CID 171901136) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-5-yl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(2,3-dihydro-1H-indol-5-yl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901136 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-5-yl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C12H14N2O2/c13-5-3-11(15)12(16)9-1-2-10-8(7-9)4-6-14-10/h1-2,7,11-12,14-16H,3-4,6H2 |
| InChIKey | DKAJYWWSBDJRIO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |