C12H10N2O4 — CID 171901747
4-(2,3-dioxo-1H-indol-6-yl)-3,4-dihydroxybutanenitrile (PubChem CID 171901747) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 4-(2,3-dioxo-1H-indol-6-yl)-3,4-dihydroxybutanenitrile.
| Compound Name | 4-(2,3-dioxo-1H-indol-6-yl)-3,4-dihydroxybutanenitrile |
|---|---|
| PubChem CID | 171901747 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 4-(2,3-dioxo-1H-indol-6-yl)-3,4-dihydroxybutanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc2c(c1)NC(=O)C2=O |
| InChI | InChI=1S/C12H10N2O4/c13-4-3-9(15)10(16)6-1-2-7-8(5-6)14-12(18)11(7)17/h1-2,5,9-10,15-16H,3H2,(H,14,17,18) |
| InChIKey | BUTMUPSDNHHXQV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|