C12H12N2O3 — CID 171901199
3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-6-yl)butanenitrile (PubChem CID 171901199) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-6-yl)butanenitrile.
| Compound Name | 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-6-yl)butanenitrile |
|---|---|
| PubChem CID | 171901199 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3,4-dihydroxy-4-(2-oxo-1,3-dihydroindol-6-yl)butanenitrile |
| SMILES | N#CCC(O)C(O)c1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C12H12N2O3/c13-4-3-10(15)12(17)8-2-1-7-6-11(16)14-9(7)5-8/h1-2,5,10,12,15,17H,3,6H2,(H,14,16) |
| InChIKey | UICIRZCCBJGDKU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |