C14H13IO2S — CID 79684302
3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanol (PubChem CID 79684302) has the molecular formula C14H13IO2S and a molecular weight of 372.23 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79684302 |
| Molecular Formula | C14H13IO2S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 3,4-dihydro-2H-chromen-6-yl-(5-iodothiophen-3-yl)methanol |
| SMILES | OC(c1csc(I)c1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H13IO2S/c15-13-7-11(8-18-13)14(16)10-3-4-12-9(6-10)2-1-5-17-12/h3-4,6-8,14,16H,1-2,5H2 |
| InChIKey | IRNGWABLFUJCND-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|