C19H22N2O2 — CID 119320933
(2R)-2-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]propanamide (PubChem CID 119320933) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2R)-2-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]propanamide.
| Compound Name | (2R)-2-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]propanamide |
|---|---|
| PubChem CID | 119320933 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (2R)-2-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]propanamide |
| SMILES | C[C@@H](N)C(=O)NC(c1ccccc1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C19H22N2O2/c1-13(20)19(22)21-18(14-6-3-2-4-7-14)16-9-10-17-15(12-16)8-5-11-23-17/h2-4,6-7,9-10,12-13,18H,5,8,11,20H2,1H3,(H,21,22)/t13-,18?/m1/s1 |
| InChIKey | AQEKPHZNFSWZRA-YJJYDOSJSA-N |
| XLogP | 2.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |