C21H24N2O3 — CID 119779081
N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]morpholine-2-carboxamide (PubChem CID 119779081) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]morpholine-2-carboxamide.
| Compound Name | N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119779081 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]morpholine-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc2c(c1)CCCO2)C1CNCCO1 |
| InChI | InChI=1S/C21H24N2O3/c24-21(19-14-22-10-12-26-19)23-20(15-5-2-1-3-6-15)17-8-9-18-16(13-17)7-4-11-25-18/h1-3,5-6,8-9,13,19-20,22H,4,7,10-12,14H2,(H,23,24) |
| InChIKey | RHUCUNUNHIJCMJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |