C21H26N2O2 — CID 120562483
4-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]pentanamide (PubChem CID 120562483) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]pentanamide.
| Compound Name | 4-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 120562483 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 4-amino-N-[3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]pentanamide |
| SMILES | CC(N)CCC(=O)NC(c1ccccc1)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C21H26N2O2/c1-15(22)9-12-20(24)23-21(16-6-3-2-4-7-16)18-10-11-19-17(14-18)8-5-13-25-19/h2-4,6-7,10-11,14-15,21H,5,8-9,12-13,22H2,1H3,(H,23,24) |
| InChIKey | RLLXXNSNGILBKU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |