About (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide
(3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide (PubChem CID 95319395) has the molecular formula C21H23NO3
and a molecular weight of 337.42 g/mol. Its IUPAC name is (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide.
Molecular Properties
| Compound Name | (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide |
| PubChem CID | 95319395 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)c1ccc2c(c1)CCCO2)[C@H]1CCOC1 |
| InChI | InChI=1S/C21H23NO3/c23-21(18-10-12-24-14-18)22-20(15-5-2-1-3-6-15)17-8-9-19-16(13-17)7-4-11-25-19/h1-3,5-6,8-9,13,18,20H,4,7,10-12,14H2,(H,22,23)/t18-,20+/m0/s1 |
| InChIKey | WTMOEXFOKXKZIE-AZUAARDMSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide?
The IUPAC name of (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide (CID 95319395) is (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide.
What is the SMILES notation for (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide?
The canonical SMILES for (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide is O=C(N[C@H](c1ccccc1)c1ccc2c(c1)CCCO2)[C@H]1CCOC1.
What is the InChIKey of (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide?
The InChIKey is WTMOEXFOKXKZIE-AZUAARDMSA-N. The full InChI is InChI=1S/C21H23NO3/c23-21(18-10-12-24-14-18)22-20(15-5-2-1-3-6-15)17-8-9-19-16(13-17)7-4-11-25-19/h1-3,5-6,8-9,13,18,20H,4,7,10-12,14H2,(H,22,23)/t18-,20+/m0/s1.
What are the key properties of (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide?
(3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide has a molecular weight of 337.42 g/mol, XLogP of 3.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[(R)-3,4-dihydro-2H-chromen-6-yl(phenyl)methyl]oxolane-3-carboxamide is sourced from PubChem (CID 95319395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).