C12H17N3O2 — CID 116849405
2-amino-2-(3,4-dihydro-2H-chromen-6-yl)-N'-methylacetohydrazide (PubChem CID 116849405) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-amino-2-(3,4-dihydro-2H-chromen-6-yl)-N'-methylacetohydrazide.
| Compound Name | 2-amino-2-(3,4-dihydro-2H-chromen-6-yl)-N'-methylacetohydrazide |
|---|---|
| PubChem CID | 116849405 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-amino-2-(3,4-dihydro-2H-chromen-6-yl)-N'-methylacetohydrazide |
| SMILES | CNNC(=O)C(N)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C12H17N3O2/c1-14-15-12(16)11(13)9-4-5-10-8(7-9)3-2-6-17-10/h4-5,7,11,14H,2-3,6,13H2,1H3,(H,15,16) |
| InChIKey | DQCIGTSKKVMJGP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|