C16H24N2O2 — CID 62932981
5-amino-5-(3,4-dihydro-2H-chromen-6-yl)-3,3-dimethylpentanamide (PubChem CID 62932981) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-amino-5-(3,4-dihydro-2H-chromen-6-yl)-3,3-dimethylpentanamide.
| Compound Name | 5-amino-5-(3,4-dihydro-2H-chromen-6-yl)-3,3-dimethylpentanamide |
|---|---|
| PubChem CID | 62932981 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 5-amino-5-(3,4-dihydro-2H-chromen-6-yl)-3,3-dimethylpentanamide |
| SMILES | CC(C)(CC(N)=O)CC(N)c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,10-15(18)19)9-13(17)11-5-6-14-12(8-11)4-3-7-20-14/h5-6,8,13H,3-4,7,9-10,17H2,1-2H3,(H2,18,19) |
| InChIKey | JJXDRENGGUASFS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |