C13H19N3O — CID 116849328
2-amino-N'-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetohydrazide (PubChem CID 116849328) has the molecular formula C13H19N3O and a molecular weight of 233.32 g/mol. Its IUPAC name is 2-amino-N'-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetohydrazide.
| Compound Name | 2-amino-N'-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 116849328 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 2-amino-N'-methyl-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetohydrazide |
| SMILES | CNNC(=O)C(N)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C13H19N3O/c1-15-16-13(17)12(14)11-7-6-9-4-2-3-5-10(9)8-11/h6-8,12,15H,2-5,14H2,1H3,(H,16,17) |
| InChIKey | QHOJFZMIBIAZBT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|