C13H16FNO3 — CID 117385569
2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)piperidine (PubChem CID 117385569) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)piperidine.
| Compound Name | 2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)piperidine |
|---|---|
| PubChem CID | 117385569 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 2-(6-fluoro-5-methoxy-1,3-benzodioxol-4-yl)piperidine |
| SMILES | COc1c(F)cc2c(c1C1CCCCN1)OCO2 |
| InChI | InChI=1S/C13H16FNO3/c1-16-12-8(14)6-10-13(18-7-17-10)11(12)9-4-2-3-5-15-9/h6,9,15H,2-5,7H2,1H3 |
| InChIKey | KVZRWOCSIBZSEE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |