C12H13BrFNO2 — CID 117486174
2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)piperidine (PubChem CID 117486174) has the molecular formula C12H13BrFNO2 and a molecular weight of 302.14 g/mol. Its IUPAC name is 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)piperidine.
| Compound Name | 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)piperidine |
|---|---|
| PubChem CID | 117486174 |
| Molecular Formula | C12H13BrFNO2 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-(6-bromo-5-fluoro-1,3-benzodioxol-4-yl)piperidine |
| SMILES | Fc1c(Br)cc2c(c1C1CCCCN1)OCO2 |
| InChI | InChI=1S/C12H13BrFNO2/c13-7-5-9-12(17-6-16-9)10(11(7)14)8-3-1-2-4-15-8/h5,8,15H,1-4,6H2 |
| InChIKey | HYBFRUKKDJPRCC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |