C13H16FNO3 — CID 117385564
5-fluoro-7-piperidin-2-yl-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 117385564) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is 5-fluoro-7-piperidin-2-yl-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 5-fluoro-7-piperidin-2-yl-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 117385564 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 5-fluoro-7-piperidin-2-yl-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | Oc1c(C2CCCCN2)cc2c(c1F)OCCO2 |
| InChI | InChI=1S/C13H16FNO3/c14-11-12(16)8(9-3-1-2-4-15-9)7-10-13(11)18-6-5-17-10/h7,9,15-16H,1-6H2 |
| InChIKey | UXGACESIMNOFKO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|