C13H16N2O3 — CID 142542894
ethane;4-methoxy-8-methyl-[1,3]dioxolo[4,5-g]quinazoline (PubChem CID 142542894) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is ethane;4-methoxy-8-methyl-[1,3]dioxolo[4,5-g]quinazoline.
| Compound Name | ethane;4-methoxy-8-methyl-[1,3]dioxolo[4,5-g]quinazoline |
|---|---|
| PubChem CID | 142542894 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | ethane;4-methoxy-8-methyl-[1,3]dioxolo[4,5-g]quinazoline |
| SMILES | CC.COc1c2c(cc3c(C)ncnc13)OCO2 |
| InChI | InChI=1S/C11H10N2O3.C2H6/c1-6-7-3-8-10(16-5-15-8)11(14-2)9(7)13-4-12-6;1-2/h3-4H,5H2,1-2H3;1-2H3 |
| InChIKey | ZWGPCJJPTQBTSG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |