C16H16BrNO3 — CID 61168746
N-(1,3-benzodioxol-4-ylmethyl)-3-bromo-2-(methoxymethyl)aniline (PubChem CID 61168746) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is N-(1,3-benzodioxol-4-ylmethyl)-3-bromo-2-(methoxymethyl)aniline.
| Compound Name | N-(1,3-benzodioxol-4-ylmethyl)-3-bromo-2-(methoxymethyl)aniline |
|---|---|
| PubChem CID | 61168746 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(1,3-benzodioxol-4-ylmethyl)-3-bromo-2-(methoxymethyl)aniline |
| SMILES | COCc1c(Br)cccc1NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C16H16BrNO3/c1-19-9-12-13(17)5-3-6-14(12)18-8-11-4-2-7-15-16(11)21-10-20-15/h2-7,18H,8-10H2,1H3 |
| InChIKey | SKJRAFHBMVSUSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |