C10H10O5 — CID 19967040
methyl 7-methoxy-1,3-benzodioxole-4-carboxylate (PubChem CID 19967040) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is methyl 7-methoxy-1,3-benzodioxole-4-carboxylate.
| Compound Name | methyl 7-methoxy-1,3-benzodioxole-4-carboxylate |
|---|---|
| PubChem CID | 19967040 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | methyl 7-methoxy-1,3-benzodioxole-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC)c2c1OCO2 |
| InChI | InChI=1S/C10H10O5/c1-12-7-4-3-6(10(11)13-2)8-9(7)15-5-14-8/h3-4H,5H2,1-2H3 |
| InChIKey | INTJVRIGDKZOJI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |