C14H14O6 — CID 57301412
methyl 2-[(7-methoxy-1,3-benzodioxol-4-yl)methylidene]-3-oxobutanoate (PubChem CID 57301412) has the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 2-[(7-methoxy-1,3-benzodioxol-4-yl)methylidene]-3-oxobutanoate.
| Compound Name | methyl 2-[(7-methoxy-1,3-benzodioxol-4-yl)methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 57301412 |
| Molecular Formula | C14H14O6 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | methyl 2-[(7-methoxy-1,3-benzodioxol-4-yl)methylidene]-3-oxobutanoate |
| SMILES | COC(=O)C(=Cc1ccc(OC)c2c1OCO2)C(C)=O |
| InChI | InChI=1S/C14H14O6/c1-8(15)10(14(16)18-3)6-9-4-5-11(17-2)13-12(9)19-7-20-13/h4-6H,7H2,1-3H3 |
| InChIKey | IJKKDTXCPRMZNH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|