C16H21N7 — CID 117089787
9-propan-2-yl-6-N-propyl-8-N-pyridin-3-ylpurine-6,8-diamine (PubChem CID 117089787) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is 9-propan-2-yl-6-N-propyl-8-N-pyridin-3-ylpurine-6,8-diamine.
| Compound Name | 9-propan-2-yl-6-N-propyl-8-N-pyridin-3-ylpurine-6,8-diamine |
|---|---|
| PubChem CID | 117089787 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 9-propan-2-yl-6-N-propyl-8-N-pyridin-3-ylpurine-6,8-diamine |
| SMILES | CCCNc1ncnc2c1nc(Nc1cccnc1)n2C(C)C |
| InChI | InChI=1S/C16H21N7/c1-4-7-18-14-13-15(20-10-19-14)23(11(2)3)16(22-13)21-12-6-5-8-17-9-12/h5-6,8-11H,4,7H2,1-3H3,(H,21,22)(H,18,19,20) |
| InChIKey | ONWQCHSROHRDAS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |