C20H25N7O — CID 117091182
N-cyclopropyl-8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-amine (PubChem CID 117091182) has the molecular formula C20H25N7O and a molecular weight of 379.47 g/mol. Its IUPAC name is N-cyclopropyl-8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-amine.
| Compound Name | N-cyclopropyl-8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-amine |
|---|---|
| PubChem CID | 117091182 |
| Molecular Formula | C20H25N7O |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-cyclopropyl-8-(6-morpholin-4-yl-3-pyridinyl)-9-propan-2-ylpurin-6-amine |
| SMILES | CC(C)n1c(-c2ccc(N3CCOCC3)nc2)nc2c(NC3CC3)ncnc21 |
| InChI | InChI=1S/C20H25N7O/c1-13(2)27-19(14-3-6-16(21-11-14)26-7-9-28-10-8-26)25-17-18(24-15-4-5-15)22-12-23-20(17)27/h3,6,11-13,15H,4-5,7-10H2,1-2H3,(H,22,23,24) |
| InChIKey | SKIBSEKKUMYBTB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |