C18H20N4O — CID 137293753
2-[4-methyl-6-(3-pyrrol-1-ylpropylamino)pyrimidin-2-yl]phenol (PubChem CID 137293753) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-[4-methyl-6-(3-pyrrol-1-ylpropylamino)pyrimidin-2-yl]phenol.
| Compound Name | 2-[4-methyl-6-(3-pyrrol-1-ylpropylamino)pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 137293753 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[4-methyl-6-(3-pyrrol-1-ylpropylamino)pyrimidin-2-yl]phenol |
| SMILES | Cc1cc(NCCCn2cccc2)nc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C18H20N4O/c1-14-13-17(19-9-6-12-22-10-4-5-11-22)21-18(20-14)15-7-2-3-8-16(15)23/h2-5,7-8,10-11,13,23H,6,9,12H2,1H3,(H,19,20,21) |
| InChIKey | ALIRSXOWWJKBGJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|