C24H25ClN4O2 — CID 16884417
2-[4-[4-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-6-phenylpyridazin-3-one (PubChem CID 16884417) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-6-phenylpyridazin-3-one.
| Compound Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-6-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 16884417 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-[4-[4-(3-chlorophenyl)piperazin-1-yl]-4-oxobutyl]-6-phenylpyridazin-3-one |
| SMILES | O=C(CCCn1nc(-c2ccccc2)ccc1=O)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C24H25ClN4O2/c25-20-8-4-9-21(18-20)27-14-16-28(17-15-27)23(30)10-5-13-29-24(31)12-11-22(26-29)19-6-2-1-3-7-19/h1-4,6-9,11-12,18H,5,10,13-17H2 |
| InChIKey | KENXTTYEWZDGPD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |