C32H34N4O2 — CID 16885757
2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-(4-methylphenyl)pyridazin-3-one (PubChem CID 16885757) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-(4-methylphenyl)pyridazin-3-one.
| Compound Name | 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-(4-methylphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 16885757 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[4-(4-benzhydrylpiperazin-1-yl)-4-oxobutyl]-6-(4-methylphenyl)pyridazin-3-one |
| SMILES | Cc1ccc(-c2ccc(=O)n(CCCC(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C32H34N4O2/c1-25-14-16-26(17-15-25)29-18-19-31(38)36(33-29)20-8-13-30(37)34-21-23-35(24-22-34)32(27-9-4-2-5-10-27)28-11-6-3-7-12-28/h2-7,9-12,14-19,32H,8,13,20-24H2,1H3 |
| InChIKey | BRULFKXYKIAXPN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |