C25H25F3N4O2 — CID 16884528
2-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6-phenylpyridazin-3-one (PubChem CID 16884528) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is 2-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6-phenylpyridazin-3-one.
| Compound Name | 2-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 16884528 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-6-phenylpyridazin-3-one |
| SMILES | O=C(CCCn1nc(-c2ccccc2)ccc1=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H25F3N4O2/c26-25(27,28)20-8-4-9-21(18-20)30-14-16-31(17-15-30)23(33)10-5-13-32-24(34)12-11-22(29-32)19-6-2-1-3-7-19/h1-4,6-9,11-12,18H,5,10,13-17H2 |
| InChIKey | ATVTZBYUFIXCDH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |