C22H27F3N4O3 — CID 32746601
3-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 32746601) has the molecular formula C22H27F3N4O3 and a molecular weight of 452.48 g/mol. Its IUPAC name is 3-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 32746601 |
| Molecular Formula | C22H27F3N4O3 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C(CCCN1C(=O)NC2(CCCC2)C1=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H27F3N4O3/c23-22(24,25)16-5-3-6-17(15-16)27-11-13-28(14-12-27)18(30)7-4-10-29-19(31)21(26-20(29)32)8-1-2-9-21/h3,5-6,15H,1-2,4,7-14H2,(H,26,32) |
| InChIKey | YCSHJJDXERNETD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|