C23H28F3N3O3 — CID 55594132
N-cyclopropyl-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide (PubChem CID 55594132) has the molecular formula C23H28F3N3O3 and a molecular weight of 451.49 g/mol. Its IUPAC name is N-cyclopropyl-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide.
| Compound Name | N-cyclopropyl-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 55594132 |
| Molecular Formula | C23H28F3N3O3 |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-cyclopropyl-4-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)-N-[1-[3-(trifluoromethyl)phenyl]ethyl]butanamide |
| SMILES | CC(c1cccc(C(F)(F)F)c1)N(C(=O)CCCN1C(=O)NC2(CCCC2)C1=O)C1CC1 |
| InChI | InChI=1S/C23H28F3N3O3/c1-15(16-6-4-7-17(14-16)23(24,25)26)29(18-9-10-18)19(30)8-5-13-28-20(31)22(27-21(28)32)11-2-3-12-22/h4,6-7,14-15,18H,2-3,5,8-13H2,1H3,(H,27,32) |
| InChIKey | BGZDTWUTJLOZOV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|