C24H24F3N5O3 — CID 20893601
12-methyl-10-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one (PubChem CID 20893601) has the molecular formula C24H24F3N5O3 and a molecular weight of 487.48 g/mol. Its IUPAC name is 12-methyl-10-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one.
| Compound Name | 12-methyl-10-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one |
|---|---|
| PubChem CID | 20893601 |
| Molecular Formula | C24H24F3N5O3 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 12-methyl-10-[4-oxo-4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one |
| SMILES | Cc1nn(CCCC(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c(=O)c2cc3occc3n12 |
| InChI | InChI=1S/C24H24F3N5O3/c1-16-28-31(23(34)20-15-21-19(32(16)20)7-13-35-21)8-3-6-22(33)30-11-9-29(10-12-30)18-5-2-4-17(14-18)24(25,26)27/h2,4-5,7,13-15H,3,6,8-12H2,1H3 |
| InChIKey | IOACJQGOSOCDFN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |