C17H20N4O3 — CID 6623274
10-(4-oxo-4-piperidin-1-ylbutyl)-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one (PubChem CID 6623274) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 10-(4-oxo-4-piperidin-1-ylbutyl)-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one.
| Compound Name | 10-(4-oxo-4-piperidin-1-ylbutyl)-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one |
|---|---|
| PubChem CID | 6623274 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 10-(4-oxo-4-piperidin-1-ylbutyl)-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-9-one |
| SMILES | O=C(CCCn1ncn2c(cc3occc32)c1=O)N1CCCCC1 |
| InChI | InChI=1S/C17H20N4O3/c22-16(19-7-2-1-3-8-19)5-4-9-21-17(23)14-11-15-13(6-10-24-15)20(14)12-18-21/h6,10-12H,1-5,7-9H2 |
| InChIKey | MKGPXMDUHVCWMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |