C16H20N4O3 — CID 20885616
N-(3-methylbutyl)-2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide (PubChem CID 20885616) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide.
| Compound Name | N-(3-methylbutyl)-2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide |
|---|---|
| PubChem CID | 20885616 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(3-methylbutyl)-2-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)propanamide |
| SMILES | CC(C)CCNC(=O)C(C)n1ncn2c(cc3occc32)c1=O |
| InChI | InChI=1S/C16H20N4O3/c1-10(2)4-6-17-15(21)11(3)20-16(22)13-8-14-12(5-7-23-14)19(13)9-18-20/h5,7-11H,4,6H2,1-3H3,(H,17,21) |
| InChIKey | RFDXWEDSWFKDLA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |