C19H17ClN4O3 — CID 20893811
N-[(4-chlorophenyl)methyl]-4-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)butanamide (PubChem CID 20893811) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)butanamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)butanamide |
|---|---|
| PubChem CID | 20893811 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-(9-oxo-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,11-tetraen-10-yl)butanamide |
| SMILES | O=C(CCCn1ncn2c(cc3occc32)c1=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClN4O3/c20-14-5-3-13(4-6-14)11-21-18(25)2-1-8-24-19(26)16-10-17-15(7-9-27-17)23(16)12-22-24/h3-7,9-10,12H,1-2,8,11H2,(H,21,25) |
| InChIKey | AWPSSVXVCUXRCF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |