C27H33ClF3N5O2 — CID 13369917
2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]-1,2,4-triazol-3-one (PubChem CID 13369917) has the molecular formula C27H33ClF3N5O2 and a molecular weight of 552.04 g/mol. Its IUPAC name is 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]-1,2,4-triazol-3-one.
| Compound Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 13369917 |
| Molecular Formula | C27H33ClF3N5O2 |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 2-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-5-ethyl-4-[3-[3-(trifluoromethyl)phenoxy]propyl]-1,2,4-triazol-3-one |
| SMILES | CCc1nn(CCCN2CCN(c3cccc(Cl)c3)CC2)c(=O)n1CCCOc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H33ClF3N5O2/c1-2-25-32-36(13-5-11-33-14-16-34(17-15-33)23-9-4-8-22(28)20-23)26(37)35(25)12-6-18-38-24-10-3-7-21(19-24)27(29,30)31/h3-4,7-10,19-20H,2,5-6,11-18H2,1H3 |
| InChIKey | BQLYOIFCWAVJAP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|