C23H30Cl2N2O — CID 10310023
3-[(3-chlorophenyl)methyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]-2-methylpentan-3-ol (PubChem CID 10310023) has the molecular formula C23H30Cl2N2O and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-[(3-chlorophenyl)methyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]-2-methylpentan-3-ol.
| Compound Name | 3-[(3-chlorophenyl)methyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 10310023 |
| Molecular Formula | C23H30Cl2N2O |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-[(3-chlorophenyl)methyl]-1-[4-(3-chlorophenyl)piperazin-1-yl]-2-methylpentan-3-ol |
| SMILES | CCC(O)(Cc1cccc(Cl)c1)C(C)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H30Cl2N2O/c1-3-23(28,16-19-6-4-7-20(24)14-19)18(2)17-26-10-12-27(13-11-26)22-9-5-8-21(25)15-22/h4-9,14-15,18,28H,3,10-13,16-17H2,1-2H3 |
| InChIKey | WHKOEXOJWVRRKE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |