C22H28ClFN2O — CID 10126572
1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-fluorophenyl)-2-methylpentan-3-ol (PubChem CID 10126572) has the molecular formula C22H28ClFN2O and a molecular weight of 390.93 g/mol. Its IUPAC name is 1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-fluorophenyl)-2-methylpentan-3-ol.
| Compound Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-fluorophenyl)-2-methylpentan-3-ol |
|---|---|
| PubChem CID | 10126572 |
| Molecular Formula | C22H28ClFN2O |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[4-(3-chlorophenyl)piperazin-1-yl]-3-(3-fluorophenyl)-2-methylpentan-3-ol |
| SMILES | CCC(O)(c1cccc(F)c1)C(C)CN1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H28ClFN2O/c1-3-22(27,18-6-4-8-20(24)14-18)17(2)16-25-10-12-26(13-11-25)21-9-5-7-19(23)15-21/h4-9,14-15,17,27H,3,10-13,16H2,1-2H3 |
| InChIKey | ORFHXAONEQMRCI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |