C13H20FN3O — CID 82298497
1-amino-3-[4-(3-fluorophenyl)piperazin-1-yl]propan-2-ol (PubChem CID 82298497) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-amino-3-[4-(3-fluorophenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-amino-3-[4-(3-fluorophenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 82298497 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-amino-3-[4-(3-fluorophenyl)piperazin-1-yl]propan-2-ol |
| SMILES | NCC(O)CN1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H20FN3O/c14-11-2-1-3-12(8-11)17-6-4-16(5-7-17)10-13(18)9-15/h1-3,8,13,18H,4-7,9-10,15H2 |
| InChIKey | OQYWIOJWXZKBKO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |