C20H25FN4O — CID 155561279
(NZ)-N-[1-(4-fluorophenyl)-4-(4-pyridin-2-yl-1,4-diazepan-1-yl)butylidene]hydroxylamine (PubChem CID 155561279) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is (NZ)-N-[1-(4-fluorophenyl)-4-(4-pyridin-2-yl-1,4-diazepan-1-yl)butylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(4-fluorophenyl)-4-(4-pyridin-2-yl-1,4-diazepan-1-yl)butylidene]hydroxylamine |
|---|---|
| PubChem CID | 155561279 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (NZ)-N-[1-(4-fluorophenyl)-4-(4-pyridin-2-yl-1,4-diazepan-1-yl)butylidene]hydroxylamine |
| SMILES | O/N=C(/CCCN1CCCN(c2ccccn2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN4O/c21-18-9-7-17(8-10-18)19(23-26)5-3-12-24-13-4-14-25(16-15-24)20-6-1-2-11-22-20/h1-2,6-11,26H,3-5,12-16H2/b23-19- |
| InChIKey | DXUQNBORIUMGPM-NMWGTECJSA-N |
| XLogP | 3.39 |
| TPSA | 51.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|