C21H28N4O — CID 11416883
(Z)-1-(3,4-dimethylphenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine (PubChem CID 11416883) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is (Z)-1-(3,4-dimethylphenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine.
| Compound Name | (Z)-1-(3,4-dimethylphenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 11416883 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (Z)-1-(3,4-dimethylphenyl)-N-methoxy-3-(4-pyridin-2-ylpiperazin-1-yl)propan-1-imine |
| SMILES | CO/N=C(/CCN1CCN(c2ccccn2)CC1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C21H28N4O/c1-17-7-8-19(16-18(17)2)20(23-26-3)9-11-24-12-14-25(15-13-24)21-6-4-5-10-22-21/h4-8,10,16H,9,11-15H2,1-3H3/b23-20- |
| InChIKey | MRMGHZXOIGVEQW-ATJXCDBQSA-N |
| XLogP | 3.26 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|