C30H34N2O4 — CID 97301886
1-[5-[4-[(E)-1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]pentyl]pyrrolidine (PubChem CID 97301886) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 1-[5-[4-[(E)-1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]pentyl]pyrrolidine.
| Compound Name | 1-[5-[4-[(E)-1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]pentyl]pyrrolidine |
|---|---|
| PubChem CID | 97301886 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 1-[5-[4-[(E)-1-(4-methoxyphenyl)-2-nitro-2-phenylethenyl]phenoxy]pentyl]pyrrolidine |
| SMILES | COc1ccc(/C(=C(/c2ccccc2)[N+](=O)[O-])c2ccc(OCCCCCN3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-35-27-16-12-24(13-17-27)29(30(32(33)34)26-10-4-2-5-11-26)25-14-18-28(19-15-25)36-23-9-3-6-20-31-21-7-8-22-31/h2,4-5,10-19H,3,6-9,20-23H2,1H3/b30-29+ |
| InChIKey | SBAIVPNVVSAUCN-QVIHXGFCSA-N |
| XLogP | 6.53 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|