C22H25F3N4O — CID 25073254
5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine (PubChem CID 25073254) has the molecular formula C22H25F3N4O and a molecular weight of 418.46 g/mol. Its IUPAC name is 5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine.
| Compound Name | 5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 25073254 |
| Molecular Formula | C22H25F3N4O |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butoxy]pyrazolo[1,5-a]pyridine |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCCCOc3ccn4nccc4c3)CC2)c1 |
| InChI | InChI=1S/C22H25F3N4O/c23-22(24,25)18-4-3-5-19(16-18)28-13-11-27(12-14-28)9-1-2-15-30-21-7-10-29-20(17-21)6-8-26-29/h3-8,10,16-17H,1-2,9,11-15H2 |
| InChIKey | UDFBYOWSQWBBCP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|