C22H28N4O2S — CID 155529400
5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-1,3-benzothiazol-2-amine (PubChem CID 155529400) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-1,3-benzothiazol-2-amine.
| Compound Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 155529400 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butoxy]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccccc1N1CCN(CCCCOc2ccc3sc(N)nc3c2)CC1 |
| InChI | InChI=1S/C22H28N4O2S/c1-27-20-7-3-2-6-19(20)26-13-11-25(12-14-26)10-4-5-15-28-17-8-9-21-18(16-17)24-22(23)29-21/h2-3,6-9,16H,4-5,10-15H2,1H3,(H2,23,24) |
| InChIKey | CTTVMGVVWWHIMC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|