C26H35N3O3 — CID 46534246
(E)-3-(4-butoxy-3-methoxyphenyl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 46534246) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-methoxyphenyl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-butoxy-3-methoxyphenyl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 46534246 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | (E)-3-(4-butoxy-3-methoxyphenyl)-N-[2-(4-ethylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(/C=C/C(=O)Nc2ccccc2N2CCN(CC)CC2)cc1OC |
| InChI | InChI=1S/C26H35N3O3/c1-4-6-19-32-24-13-11-21(20-25(24)31-3)12-14-26(30)27-22-9-7-8-10-23(22)29-17-15-28(5-2)16-18-29/h7-14,20H,4-6,15-19H2,1-3H3,(H,27,30)/b14-12+ |
| InChIKey | VRIDJLJEOPPUKL-WYMLVPIESA-N |
| XLogP | 4.67 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|