C26H35N3O3 — CID 72686621
3-(4-butoxy-3-methoxyphenyl)-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 72686621) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 3-(4-butoxy-3-methoxyphenyl)-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | 3-(4-butoxy-3-methoxyphenyl)-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72686621 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 3-(4-butoxy-3-methoxyphenyl)-N-[2-[(1-methylpiperidin-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccc(C=CC(=O)Nc2ccccc2NC2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C26H35N3O3/c1-4-5-18-32-24-12-10-20(19-25(24)31-3)11-13-26(30)28-23-9-7-6-8-22(23)27-21-14-16-29(2)17-15-21/h6-13,19,21,27H,4-5,14-18H2,1-3H3,(H,28,30) |
| InChIKey | VPDUZKGQLHXJPH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|