C29H31N3O3S — CID 126154661
(5Z)-3-benzyl-5-[[7-ethyl-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126154661) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[7-ethyl-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[[7-ethyl-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126154661 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (5Z)-3-benzyl-5-[[7-ethyl-1-[2-[(2S)-2-methylpiperidin-1-yl]-2-oxoethyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(Cc4ccccc4)C3=O)cn(CC(=O)N3CCCC[C@@H]3C)c12 |
| InChI | InChI=1S/C29H31N3O3S/c1-3-22-13-9-14-24-23(18-30(27(22)24)19-26(33)31-15-8-7-10-20(31)2)16-25-28(34)32(29(35)36-25)17-21-11-5-4-6-12-21/h4-6,9,11-14,16,18,20H,3,7-8,10,15,17,19H2,1-2H3/b25-16-/t20-/m0/s1 |
| InChIKey | PMUUYWDCPDVTMJ-HBAFHOPNSA-N |
| XLogP | 5.84 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|