C23H27BrN4O2S — CID 126147755
(5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126147755) has the molecular formula C23H27BrN4O2S and a molecular weight of 503.47 g/mol. Its IUPAC name is (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126147755 |
| Molecular Formula | C23H27BrN4O2S |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | (5Z)-5-[[1-[2-(azepan-1-yl)-2-oxoethyl]-5-bromoindol-3-yl]methylidene]-3-ethyl-1-methyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCN1C(=O)/C(=C/c2cn(CC(=O)N3CCCCCC3)c3ccc(Br)cc23)N(C)C1=S |
| InChI | InChI=1S/C23H27BrN4O2S/c1-3-28-22(30)20(25(2)23(28)31)12-16-14-27(19-9-8-17(24)13-18(16)19)15-21(29)26-10-6-4-5-7-11-26/h8-9,12-14H,3-7,10-11,15H2,1-2H3/b20-12- |
| InChIKey | IRCBUIJXXVUSKA-NDENLUEZSA-N |
| XLogP | 4.23 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|