C30H25ClN2O4S — CID 126130748
(5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126130748) has the molecular formula C30H25ClN2O4S and a molecular weight of 545.06 g/mol. Its IUPAC name is (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126130748 |
| Molecular Formula | C30H25ClN2O4S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | (5Z)-3-[2-(4-chlorophenyl)-2-oxoethyl]-5-[[1-[3-(4-methylphenoxy)propyl]indol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1ccc(OCCCn2cc(/C=C3\SC(=O)N(CC(=O)c4ccc(Cl)cc4)C3=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H25ClN2O4S/c1-20-7-13-24(14-8-20)37-16-4-15-32-18-22(25-5-2-3-6-26(25)32)17-28-29(35)33(30(36)38-28)19-27(34)21-9-11-23(31)12-10-21/h2-3,5-14,17-18H,4,15-16,19H2,1H3/b28-17- |
| InChIKey | AGGPTWPRLHOVRS-QRQIAZFYSA-N |
| XLogP | 6.99 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|