C22H15F4N3O2 — CID 126077666
(5E)-3-[(2-fluorophenyl)methyl]-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126077666) has the molecular formula C22H15F4N3O2 and a molecular weight of 429.37 g/mol. Its IUPAC name is (5E)-3-[(2-fluorophenyl)methyl]-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126077666 |
| Molecular Formula | C22H15F4N3O2 |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (5E)-3-[(2-fluorophenyl)methyl]-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cccn2-c2cccc(C(F)(F)F)c2)C(=O)N1Cc1ccccc1F |
| InChI | InChI=1S/C22H15F4N3O2/c23-18-9-2-1-5-14(18)13-29-20(30)19(27-21(29)31)12-17-8-4-10-28(17)16-7-3-6-15(11-16)22(24,25)26/h1-12H,13H2,(H,27,31)/b19-12+ |
| InChIKey | QJYTXTYRCVVAGI-XDHOZWIPSA-N |
| XLogP | 4.73 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|