C22H15FN3O4- — CID 7046121
3-[2-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]pyrrol-1-yl]benzoate (PubChem CID 7046121) has the molecular formula C22H15FN3O4- and a molecular weight of 404.38 g/mol. Its IUPAC name is 3-[2-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]pyrrol-1-yl]benzoate.
| Compound Name | 3-[2-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 7046121 |
| Molecular Formula | C22H15FN3O4- |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 3-[2-[(Z)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]pyrrol-1-yl]benzoate |
| SMILES | O=C([O-])c1cccc(-n2cccc2/C=C2\NC(=O)N(Cc3ccc(F)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H16FN3O4/c23-16-8-6-14(7-9-16)13-26-20(27)19(24-22(26)30)12-18-5-2-10-25(18)17-4-1-3-15(11-17)21(28)29/h1-12H,13H2,(H,24,30)(H,28,29)/p-1/b19-12- |
| InChIKey | KGNMPMDKCLEBKG-UNOMPAQXSA-M |
| XLogP | 2.07 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|