C18H16F3N3O2 — CID 126228553
(5E)-3-propyl-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione (PubChem CID 126228553) has the molecular formula C18H16F3N3O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is (5E)-3-propyl-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-propyl-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126228553 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (5E)-3-propyl-5-[[1-[3-(trifluoromethyl)phenyl]pyrrol-2-yl]methylidene]imidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2cccn2-c2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H16F3N3O2/c1-2-8-24-16(25)15(22-17(24)26)11-14-7-4-9-23(14)13-6-3-5-12(10-13)18(19,20)21/h3-7,9-11H,2,8H2,1H3,(H,22,26)/b15-11+ |
| InChIKey | WTXLVCMBAQUKLG-RVDMUPIBSA-N |
| XLogP | 3.80 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|